Products 6683-74-5
CAS 6683-74-5 appears in our catalog under these names: 2-Bromo-1,4-di-tert-butylbenzene, 95%, 95%, 2-BROMO-1,4-DI-TERT-BUTYLBENZENE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1,4-ditert-butylbenzene (CAS 6683-74-5) is a chemical compound with the molecular formula C14H21Br and a molecular weight of 269.22 g/mol. IUPAC name: 2-bromo-1,4-ditert-butylbenzene. InChIKey: JFRPIGCUUJRXMT-UHFFFAOYSA-N.
| Molecular formula | C14H21Br |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | 2-bromo-1,4-ditert-butylbenzene |
| InChIKey | JFRPIGCUUJRXMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)Br |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-1,4-di-tert-butylbenzene, 2-Bromo-1,4-bis(1,1-dimethylethyl)benzene, 2-Bromo-1,4-ditert-butylbenzene, 1-Bromo-2,5-di-tert-butylbenzene, JFRPIGCUUJRXMT-UHFFFAOYSA-N, 2-bromo-1,4-ditert-butyl-benzene, Bromobenzene, 3,6-di-tert-butyl-, 2-Bromo-1,4-ditert-butylbenzene #, 2-bromo-1 ,4-bis(1 ,1-dimethylethyl)benzene, Benzene, 2-bromo-1,4-bis(1,1-dimethylethyl)-