Products 80438-66-0
CAS 80438-66-0 appears in our catalog under these names: 1-Bromo-2,4-di-tert-butylbenzene, 98%, 1-Bromo-2,4-di-tert-butylbenzene, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g.
1-bromo-2,4-ditert-butylbenzene (CAS 80438-66-0) is a chemical compound with the molecular formula C14H21Br and a molecular weight of 269.22 g/mol. IUPAC name: 1-bromo-2,4-ditert-butylbenzene. InChIKey: BMZWJHQBAJTXFB-UHFFFAOYSA-N.
| Molecular formula | C14H21Br |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | 1-bromo-2,4-ditert-butylbenzene |
| InChIKey | BMZWJHQBAJTXFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)C(C)(C)C |
Computed by PubChem (NCBI)