CAS 66842-92-0 appears in our catalog under these names: 2-Hydroxy-3-methoxy-N,N-dimethylbenzamide, 95%, 2-Hydroxy-3-methoxy-N,N-dimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-hydroxy-3-methoxy-N,N-dimethylbenzamide (CAS 66842-92-0) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-hydroxy-3-methoxy-N,N-dimethylbenzamide. InChIKey: BKQNOAAILVLWBL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-hydroxy-3-methoxy-N,N-dimethylbenzamide |
| InChIKey | BKQNOAAILVLWBL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC=C1)OC)O |
Computed by PubChem (NCBI)