Products 66842-93-1
CAS 66842-93-1 is the registry number for 3-Hydroxy-4-methoxy-N,N-dimethylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-4-methoxy-N,N-dimethylbenzamide (CAS 66842-93-1) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 3-hydroxy-4-methoxy-N,N-dimethylbenzamide. InChIKey: VARZEWGNWSFBSY-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 3-hydroxy-4-methoxy-N,N-dimethylbenzamide |
| InChIKey | VARZEWGNWSFBSY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)OC)O |
Computed by PubChem (NCBI)