CAS 668969-63-9 is the registry number for tert-Butyl 2-amino-5-bromobenzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl 2-amino-5-bromobenzoate (CAS 668969-63-9) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 2-amino-5-bromobenzoate. InChIKey: OMHOTPHULFOYPL-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 2-amino-5-bromobenzoate |
| InChIKey | OMHOTPHULFOYPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)