CAS 66905-17-7 appears in our catalog under these names: 2,5–Dimethylbenzenesulfonic acid, dihydrate, 2,5-DIMETHYLBENZENESULFONIC ACID DIHYDRATE, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g.
2,5-dimethylbenzenesulfonic acid (CAS 66905-17-7) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: 2,5-dimethylbenzenesulfonic acid. InChIKey: IRLYGRLEBKCYPY-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 2,5-dimethylbenzenesulfonic acid |
| InChIKey | IRLYGRLEBKCYPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)O |
Computed by PubChem (NCBI)