CAS 6694-75-3 appears in our catalog under these names: 4-(Chloromethyl)-2-nitrophenol, 95%, 4–(Chloromethyl)–2–nitrophenol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
4-(chloromethyl)-2-nitrophenol (CAS 6694-75-3) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-(chloromethyl)-2-nitrophenol. InChIKey: LCYZFNFGPVNDGS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 4-(chloromethyl)-2-nitrophenol |
| InChIKey | LCYZFNFGPVNDGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)