CAS 66941-74-0 appears in our catalog under these names: 5-Allyl-5-methallyl-barbituric Acid (1mg/ml in Acetonitrile), 5-Allyl-5-methallyl-barbituric Acid. Offered by: TRC, Biosynth. Available pack sizes: 5x1ml, 100mg, 25mg, 10mg, 50mg.
5-(2-methylprop-2-enyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (CAS 66941-74-0) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 5-(2-methylprop-2-enyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione. InChIKey: OEKGSCSLYOYXDZ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 5-(2-methylprop-2-enyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| InChIKey | OEKGSCSLYOYXDZ-UHFFFAOYSA-N |
| SMILES | CC(=C)CC1(C(=O)NC(=O)NC1=O)CC=C |
Computed by PubChem (NCBI)