CAS 66949-31-3 appears in our catalog under these names: {2-((4-chlorophenyl)sulfanyl)-5-nitrophenyl}methanol, 95%, {2-((4-Chlorophenyl)sulfanyl)-5-nitrophenyl}methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methanol (CAS 66949-31-3) is a chemical compound with the molecular formula C13H10ClNO3S and a molecular weight of 295.74 g/mol. IUPAC name: [2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methanol. InChIKey: AITRBTUHXBDRBZ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO3S |
|---|---|
| Molecular weight | 295.74 g/mol |
| IUPAC name | [2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methanol |
| InChIKey | AITRBTUHXBDRBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SC2=C(C=C(C=C2)[N+](=O)[O-])CO)Cl |
Computed by PubChem (NCBI)