Products 926228-57-1

CAS 926228-57-1 is the registry number for 5-(2-Chlorobenzamido)-3-methylthiophene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxylic acid (CAS 926228-57-1) is a chemical compound with the molecular formula C13H10ClNO3S and a molecular weight of 295.74 g/mol. IUPAC name: 5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxylic acid. InChIKey: ZWWUYGVPPJUZQO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO3S
Molecular weight295.74 g/mol
IUPAC name5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxylic acid
InChIKeyZWWUYGVPPJUZQO-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1)NC(=O)C2=CC=CC=C2Cl)C(=O)O

Computed by PubChem (NCBI)