CAS 66957-71-9 appears in our catalog under these names: (2R,3S,4S,5R,6R)–2–(hydroxymethyl)–6–(pentyloxy)tetrahydro–2H–pyran–3,4,5–triol, Pentyl β-D-glucopyranoside, N-Amyl β-D-glucopyranoside. Offered by: GLPBio, Chemat, Biosynth. Available pack sizes: 1g, 2g, 500mg, 5g, 250mg, 1000mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-pentoxyoxane-3,4,5-triol (CAS 66957-71-9) is a chemical compound with the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-pentoxyoxane-3,4,5-triol. InChIKey: RYIWDDCNJPSPRA-KAMPLNKDSA-N.
| Molecular formula | C11H22O6 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-pentoxyoxane-3,4,5-triol |
| InChIKey | RYIWDDCNJPSPRA-KAMPLNKDSA-N |
| SMILES | CCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)