Products 98354-17-7

CAS 98354-17-7 is the registry number for Ethyl 3–(2–(2–(2–hydroxyethoxy)ethoxy)ethoxy)propanoate. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate (CAS 98354-17-7) is a chemical compound with the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. IUPAC name: ethyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate. InChIKey: PGCDRCTVDGPPLF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22O6
Molecular weight250.29 g/mol
IUPAC nameethyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate
InChIKeyPGCDRCTVDGPPLF-UHFFFAOYSA-N
SMILESCCOC(=O)CCOCCOCCOCCO

Computed by PubChem (NCBI)