CAS 67083-28-7 appears in our catalog under these names: 2,6-Dimethyl-3-nitroaniline, 95%, 2,6-Dimethyl-3-nitroaniline 97%, 2,6-Dimethyl-3-nitroaniline, 97%, 97%, 2,6-Dimethyl-3-nitroaniline, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
2,6-dimethyl-3-nitroaniline (CAS 67083-28-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,6-dimethyl-3-nitroaniline. InChIKey: LDFJDBAOBVUXMQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitroaniline |
| InChIKey | LDFJDBAOBVUXMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])C)N |
Computed by PubChem (NCBI)