CAS 67159-84-6 appears in our catalog under these names: 6-Bromo-3,3-dimethyl-2,3-dihydro-1h-inden-1-one, 95%, 6–BroMo–3,3–diMethyl–2,3–dihydro–1H–inden–1–one, 6-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 6-Bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one 98%, 1H-Inden-1-one, 6-bromo-2,3-dihydro-3,3-dimethyl-, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-bromo-3,3-dimethyl-2H-inden-1-one (CAS 67159-84-6) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2H-inden-1-one. InChIKey: YIFWUKQMDXTIFS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2H-inden-1-one |
| InChIKey | YIFWUKQMDXTIFS-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C=CC(=C2)Br)C |
Computed by PubChem (NCBI)