CAS 82305-04-2 is the registry number for 6-Bromo-2,2-dimethyl-2h-chromene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.
6-bromo-2,2-dimethylchromene (CAS 82305-04-2) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 6-bromo-2,2-dimethylchromene. InChIKey: FHBXFINOQUIMDK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 6-bromo-2,2-dimethylchromene |
| InChIKey | FHBXFINOQUIMDK-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)