Products 672333-91-4
CAS 672333-91-4 is the registry number for OP-Lysine. Offered by: Iris Biotech. Available pack sizes: 5mg.
(2S)-2-amino-6-(3-hydroxypyridin-1-ium-1-yl)hexanoate (CAS 672333-91-4) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: (2S)-2-amino-6-(3-hydroxypyridin-1-ium-1-yl)hexanoate. InChIKey: KMIMUDUXVXFAJZ-JTQLQIEISA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | (2S)-2-amino-6-(3-hydroxypyridin-1-ium-1-yl)hexanoate |
| InChIKey | KMIMUDUXVXFAJZ-JTQLQIEISA-N |
| SMILES | C1=CC(=C[N+](=C1)CCCC[C@@H](C(=O)[O-])N)O |
Computed by PubChem (NCBI)