Products 67392-69-2

CAS 67392-69-2 is the registry number for H-D-Ala-D-Leu-OH TFA Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

(2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid (CAS 67392-69-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: (2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid. InChIKey: RDIKFPRVLJLMER-RNFRBKRXSA-N.

Identity
Molecular formulaC9H18N2O3
Molecular weight202.25 g/mol
IUPAC name(2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid
InChIKeyRDIKFPRVLJLMER-RNFRBKRXSA-N
SMILESC[C@H](C(=O)N[C@H](CC(C)C)C(=O)O)N

Computed by PubChem (NCBI)