CAS 67392-69-2 is the registry number for H-D-Ala-D-Leu-OH TFA Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid (CAS 67392-69-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: (2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid. InChIKey: RDIKFPRVLJLMER-RNFRBKRXSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | RDIKFPRVLJLMER-RNFRBKRXSA-N |
| SMILES | C[C@H](C(=O)N[C@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)