CAS 67401-65-4 appears in our catalog under these names: (R)-2-((Methoxycarbonyl)amino)-3-phenylpropanoic acid, 98%, (R)–2–(methoxycarbonylamino)–3–phenylpropanoic acid, (R)-2-(methoxycarbonylamino)-3-phenylpropanoic acid, 98%, 98%, (METHOXYCARBONYL)-D-PHENYLALANINE, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
(2R)-2-(methoxycarbonylamino)-3-phenylpropanoic acid (CAS 67401-65-4) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2R)-2-(methoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: QGICDLYPUUZBIV-SECBINFHSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R)-2-(methoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | QGICDLYPUUZBIV-SECBINFHSA-N |
| SMILES | COC(=O)N[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)