Products 675856-63-0

CAS 675856-63-0 is the registry number for 4-(4-Fluorophenyl)-2,5-dimethylthiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-(4-fluorophenyl)-2,5-dimethyl-1,3-thiazole (CAS 675856-63-0) is a chemical compound with the molecular formula C11H10FNS and a molecular weight of 207.27 g/mol. IUPAC name: 4-(4-fluorophenyl)-2,5-dimethyl-1,3-thiazole. InChIKey: BYLRJAPIHKXDNV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10FNS
Molecular weight207.27 g/mol
IUPAC name4-(4-fluorophenyl)-2,5-dimethyl-1,3-thiazole
InChIKeyBYLRJAPIHKXDNV-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)C)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)