CAS 886791-53-3 is the registry number for (2-Fluorophenyl)(2-thienylmethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-fluoro-N-(thiophen-2-ylmethyl)aniline (CAS 886791-53-3) is a chemical compound with the molecular formula C11H10FNS and a molecular weight of 207.27 g/mol. IUPAC name: 2-fluoro-N-(thiophen-2-ylmethyl)aniline. InChIKey: NJZNMFGQSSIVEU-UHFFFAOYSA-N.
| Molecular formula | C11H10FNS |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-fluoro-N-(thiophen-2-ylmethyl)aniline |
| InChIKey | NJZNMFGQSSIVEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCC2=CC=CS2)F |
Computed by PubChem (NCBI)