Products 676095-45-7
CAS 676095-45-7 appears in our catalog under these names: N-Benzyl-3,3,3-trifluoropropanamide, 95%, N-Benzyl-3,3,3-trifluoropropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-benzyl-3,3,3-trifluoropropanamide (CAS 676095-45-7) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: N-benzyl-3,3,3-trifluoropropanamide. InChIKey: YIQOKYUDYYVPDM-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | N-benzyl-3,3,3-trifluoropropanamide |
| InChIKey | YIQOKYUDYYVPDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)CC(F)(F)F |
Computed by PubChem (NCBI)