Products 676129-93-4

CAS 676129-93-4 is the registry number for Des(oxopentyl) valsartan benzyl ester. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Benzyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate (CAS 676129-93-4) is a chemical compound with the molecular formula C26H27N5O2 and a molecular weight of 441.5 g/mol. IUPAC name: benzyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate. InChIKey: LNQMWQPHRJGJQL-DEOSSOPVSA-N.

Identity
Molecular formulaC26H27N5O2
Molecular weight441.5 g/mol
IUPAC namebenzyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate
InChIKeyLNQMWQPHRJGJQL-DEOSSOPVSA-N
SMILESCC(C)[C@@H](C(=O)OCC1=CC=CC=C1)NCC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4

Computed by PubChem (NCBI)