CAS 67641-28-5 is the registry number for Perfluoroallylfluorosulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,1,2,3,3-pentafluoro-3-fluorosulfonyloxyprop-1-ene (CAS 67641-28-5) is a chemical compound with the molecular formula C3F6O3S and a molecular weight of 230.09 g/mol. IUPAC name: 1,1,2,3,3-pentafluoro-3-fluorosulfonyloxyprop-1-ene. InChIKey: LIZZWVXXYAALGG-UHFFFAOYSA-N.
| Molecular formula | C3F6O3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 1,1,2,3,3-pentafluoro-3-fluorosulfonyloxyprop-1-ene |
| InChIKey | LIZZWVXXYAALGG-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(C(OS(=O)(=O)F)(F)F)F |
Computed by PubChem (NCBI)