CAS 773-15-9 appears in our catalog under these names: Hexafluoro(3-methyl-1,2-oxathietane)-2,2-dioxide, 95%, 3,4,4-Trifluoro-3-(trifluoromethyl)-1,2-oxathietane 2,2-dioxide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g.
3,4,4-trifluoro-3-(trifluoromethyl)oxathietane 2,2-dioxide (CAS 773-15-9) is a chemical compound with the molecular formula C3F6O3S and a molecular weight of 230.09 g/mol. IUPAC name: 3,4,4-trifluoro-3-(trifluoromethyl)oxathietane 2,2-dioxide. InChIKey: NRSBEUZIEWSRKT-UHFFFAOYSA-N.
| Molecular formula | C3F6O3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 3,4,4-trifluoro-3-(trifluoromethyl)oxathietane 2,2-dioxide |
| InChIKey | NRSBEUZIEWSRKT-UHFFFAOYSA-N |
| SMILES | C1(C(OS1(=O)=O)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)