CAS 67659-36-3 appears in our catalog under these names: (R)-1,1-Diphenylpropan-2-amine, 97%, (R)-(+)-1,1-DIPHENYL-2-AMINOPROPANE, 97%. Offered by: AmBeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 500MG.
(2R)-1,1-diphenylpropan-2-amine (CAS 67659-36-3) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (2R)-1,1-diphenylpropan-2-amine. InChIKey: XNKICCFGYSXSAI-GFCCVEGCSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (2R)-1,1-diphenylpropan-2-amine |
| InChIKey | XNKICCFGYSXSAI-GFCCVEGCSA-N |
| SMILES | C[C@H](C(C1=CC=CC=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)