CAS 677746-32-6 appears in our catalog under these names: 2-Hydroxy-5-nitrophenylboronic acid, 95%, (2-Hydroxy-5-nitrophenyl)boronic acid, 95+%, (2–hydroxy–5–nitrophenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 200mg.
(2-hydroxy-5-nitrophenyl)boronic acid (CAS 677746-32-6) is a chemical compound with the molecular formula C6H6BNO5 and a molecular weight of 182.93 g/mol. IUPAC name: (2-hydroxy-5-nitrophenyl)boronic acid. InChIKey: BUXUQBAJSSIJRF-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO5 |
|---|---|
| Molecular weight | 182.93 g/mol |
| IUPAC name | (2-hydroxy-5-nitrophenyl)boronic acid |
| InChIKey | BUXUQBAJSSIJRF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])O)(O)O |
Computed by PubChem (NCBI)