CAS 737001-07-9 appears in our catalog under these names: 3–Hydroxy–5–nitrophenylboronic acid, 3-Hydroxy-5-nitrophenylboronic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
(3-hydroxy-5-nitrophenyl)boronic acid (CAS 737001-07-9) is a chemical compound with the molecular formula C6H6BNO5 and a molecular weight of 182.93 g/mol. IUPAC name: (3-hydroxy-5-nitrophenyl)boronic acid. InChIKey: UWOUWIYCKIKPFP-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO5 |
|---|---|
| Molecular weight | 182.93 g/mol |
| IUPAC name | (3-hydroxy-5-nitrophenyl)boronic acid |
| InChIKey | UWOUWIYCKIKPFP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)O)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)