Products 737001-07-9

CAS 737001-07-9 appears in our catalog under these names: 3–Hydroxy–5–nitrophenylboronic acid, 3-Hydroxy-5-nitrophenylboronic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

(3-hydroxy-5-nitrophenyl)boronic acid (CAS 737001-07-9) is a chemical compound with the molecular formula C6H6BNO5 and a molecular weight of 182.93 g/mol. IUPAC name: (3-hydroxy-5-nitrophenyl)boronic acid. InChIKey: UWOUWIYCKIKPFP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6BNO5
Molecular weight182.93 g/mol
IUPAC name(3-hydroxy-5-nitrophenyl)boronic acid
InChIKeyUWOUWIYCKIKPFP-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)O)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)