CAS 67869-70-9 appears in our catalog under these names: 7-(Chloromethyl)-3,4-dihydro-2h-1,5-benzodioxepine, 95%, 7-(Chloromethyl)-3,4-dihydro-2H-benzo(b)(1,4)dioxepine, 98%, 7-(Chloromethyl)-3,4-dihydro-2H-benzo[b][1,4]dioxepine, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine (CAS 67869-70-9) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: PXZCFOABYOEFPQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | PXZCFOABYOEFPQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)CCl)OC1 |
Computed by PubChem (NCBI)