CAS 67945-22-6 is the registry number for trans-Diethyl caronate, 90%. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
Trans-diethyl (1R,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylate (CAS 67945-22-6) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: trans-diethyl (1R,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylate. InChIKey: MPRMNWDIYNBXRC-YUMQZZPRSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | trans-diethyl (1R,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylate |
| InChIKey | MPRMNWDIYNBXRC-YUMQZZPRSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](C1(C)C)C(=O)OCC |
Computed by PubChem (NCBI)