Products 6797-15-5

CAS 6797-15-5 is the registry number for 2-iso-Propylbenzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-propan-2-yl-1,3-benzoxazole (CAS 6797-15-5) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 2-propan-2-yl-1,3-benzoxazole. InChIKey: BEMLMLRIKVNBEY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO
Molecular weight161.20 g/mol
IUPAC name2-propan-2-yl-1,3-benzoxazole
InChIKeyBEMLMLRIKVNBEY-UHFFFAOYSA-N
SMILESCC(C)C1=NC2=CC=CC=C2O1

Computed by PubChem (NCBI)