CAS 68049-17-2 is the registry number for 2-(4-Fluorophenyl)pyrimidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-(4-fluorophenyl)pyrimidine (CAS 68049-17-2) is a chemical compound with the molecular formula C10H7FN2 and a molecular weight of 174.17 g/mol. IUPAC name: 2-(4-fluorophenyl)pyrimidine. InChIKey: OAJZNBBXWMPPNU-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2 |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | 2-(4-fluorophenyl)pyrimidine |
| InChIKey | OAJZNBBXWMPPNU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)