CAS 939975-25-4 appears in our catalog under these names: 2-(4-fluorophenyl)pyrazine, 95%, 2-(4-Fluorophenyl)pyrazine, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
2-(4-fluorophenyl)pyrazine (CAS 939975-25-4) is a chemical compound with the molecular formula C10H7FN2 and a molecular weight of 174.17 g/mol. IUPAC name: 2-(4-fluorophenyl)pyrazine. InChIKey: UZVXIRFNWFOGHV-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2 |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | 2-(4-fluorophenyl)pyrazine |
| InChIKey | UZVXIRFNWFOGHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CN=C2)F |
Computed by PubChem (NCBI)