Products 68054-39-7
CAS 68054-39-7 is the registry number for 3,6-Dioxo-2,5-bis(phenylamino)-1,4-cyclohexadiene-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-anilino-2-hydroxy-5-oxo-6-phenyliminocyclohexa-1,3-diene-1-carboxylic acid (CAS 68054-39-7) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: 3-anilino-2-hydroxy-5-oxo-6-phenyliminocyclohexa-1,3-diene-1-carboxylic acid. InChIKey: DRCXEUYBLRVLTI-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 3-anilino-2-hydroxy-5-oxo-6-phenyliminocyclohexa-1,3-diene-1-carboxylic acid |
| InChIKey | DRCXEUYBLRVLTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=O)C(=NC3=CC=CC=C3)C(=C2O)C(=O)O |
Computed by PubChem (NCBI)