Products 310451-97-9
CAS 310451-97-9 is the registry number for 5-(4-Aminophenoxy)-2-(furan-2-ylmethyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-aminophenoxy)-2-(furan-2-ylmethyl)isoindole-1,3-dione (CAS 310451-97-9) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: 5-(4-aminophenoxy)-2-(furan-2-ylmethyl)isoindole-1,3-dione. InChIKey: KBQAHWRFBGDJAD-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 5-(4-aminophenoxy)-2-(furan-2-ylmethyl)isoindole-1,3-dione |
| InChIKey | KBQAHWRFBGDJAD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)