Products 68054-78-4
CAS 68054-78-4 appears in our catalog under these names: 2-(Cyclohexylamino)-5-(phenylamino)-2,5-cyclohexadiene-1,4-dione, >95% (HPLC), 2-(Cyclohexylamino)-5-(phenylamino)cyclohexa-2,5-diene-1,4-dione (CPPD-Quinone), CPPD–Q, 2-(Cyclohexylamino)-5-(phenylamino)cyclohexa-2,5-diene-1,4-dione, 95.0%, 95.0%, CPPD-Q, 98.25%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 5mg, 50mg, 5 mg, 10 mg.
2-anilino-5-(cyclohexylamino)cyclohexa-2,5-diene-1,4-dione (CAS 68054-78-4) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: 2-anilino-5-(cyclohexylamino)cyclohexa-2,5-diene-1,4-dione. InChIKey: UBQBKNFAICQJRN-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-anilino-5-(cyclohexylamino)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | UBQBKNFAICQJRN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=CC(=O)C(=CC2=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)