CAS 68064-69-7 is the registry number for Clevidipine Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate (CAS 68064-69-7) is a chemical compound with the molecular formula C12H10Cl2O3 and a molecular weight of 273.11 g/mol. IUPAC name: methyl (2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate. InChIKey: QQXPSPWWWCQBFM-TWGQIWQCSA-N.
| Molecular formula | C12H10Cl2O3 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | methyl (2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate |
| InChIKey | QQXPSPWWWCQBFM-TWGQIWQCSA-N |
| SMILES | CC(=O)/C(=C/C1=C(C(=CC=C1)Cl)Cl)/C(=O)OC |
Computed by PubChem (NCBI)