CAS 68064-70-0 is the registry number for Felodipine Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2E)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate (CAS 68064-70-0) is a chemical compound with the molecular formula C12H10Cl2O3 and a molecular weight of 273.11 g/mol. IUPAC name: methyl (2E)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate. InChIKey: QQXPSPWWWCQBFM-RMKNXTFCSA-N.
| Molecular formula | C12H10Cl2O3 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | methyl (2E)-2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate |
| InChIKey | QQXPSPWWWCQBFM-RMKNXTFCSA-N |
| SMILES | CC(=O)/C(=C\C1=C(C(=CC=C1)Cl)Cl)/C(=O)OC |
Computed by PubChem (NCBI)