CAS 68076-39-1 appears in our catalog under these names: N1,N5-Bis-Boc-spermidine, 98%, 1,6-Bis-Boc-1,6,10-triazadecane, N1,N5-Bis-Boc-spermidine 95%, tert-Butyl (3-aminopropyl)(4-((tert-butoxycarbonyl)amino)butyl)carbamate, 95%, 95%, N1,N5-Bis-boc-spermidine, 95.0%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 500 mg, 1 g, 250 mg, 100 mg.
Tert-butyl N-(3-aminopropyl)-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate (CAS 68076-39-1) is a chemical compound with the molecular formula C17H35N3O4 and a molecular weight of 345.5 g/mol. IUPAC name: tert-butyl N-(3-aminopropyl)-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate. InChIKey: AGIUPQUTLBAVDK-UHFFFAOYSA-N.
| Molecular formula | C17H35N3O4 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | tert-butyl N-(3-aminopropyl)-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
| InChIKey | AGIUPQUTLBAVDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCCN)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)