CAS 85503-20-4 appears in our catalog under these names: N1,N4-Bis-Boc-spermidine, 97%, N1, N4-Bis-Boc-Spermidine, N1,N4-Bis-Boc-spermidine, N1,N4–Bis–Boc–spermidine, 1,5-Bis-Boc-1,5,10-triazadecane. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, on request, 25mg, 5g, 50mg, 100 mg.
Tert-butyl N-(4-aminobutyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (CAS 85503-20-4) is a chemical compound with the molecular formula C17H35N3O4 and a molecular weight of 345.5 g/mol. IUPAC name: tert-butyl N-(4-aminobutyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate. InChIKey: GQZZMJDEWJRWRP-UHFFFAOYSA-N.
| Molecular formula | C17H35N3O4 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | tert-butyl N-(4-aminobutyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| InChIKey | GQZZMJDEWJRWRP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCN)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)