CAS 681443-02-7 is the registry number for 3-(tert-Butyl)-4-ethoxybenzaldehyde, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-tert-butyl-4-ethoxybenzaldehyde (CAS 681443-02-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 3-tert-butyl-4-ethoxybenzaldehyde. InChIKey: DPWPVBWJIABALM-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 3-tert-butyl-4-ethoxybenzaldehyde |
| InChIKey | DPWPVBWJIABALM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C=O)C(C)(C)C |
Computed by PubChem (NCBI)