Products 68254-63-7
CAS 68254-63-7 appears in our catalog under these names: N-Ethylnicotinamide N'-oxide, Nicotinic Acid Impurity 21, 3-(Ethylcarbamoyl)pyridine 1-oxide 98%, 3-(Ethylcarbamoyl)pyridine 1-oxide, 98%, 98%, 3-(Ethylcarbamoyl)pyridine 1-oxide, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
N-ethyl-1-oxidopyridin-1-ium-3-carboxamide (CAS 68254-63-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N-ethyl-1-oxidopyridin-1-ium-3-carboxamide. InChIKey: SAVLXRIBLGVLCH-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N-ethyl-1-oxidopyridin-1-ium-3-carboxamide |
| InChIKey | SAVLXRIBLGVLCH-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C[N+](=CC=C1)[O-] |
Computed by PubChem (NCBI)