CAS 68278-23-9 appears in our catalog under these names: Eflornithine hydrochloride, 95%, Eflornithine HCl, Eflornithine hydrochloride, Eflornithine hydrochloride (DFMO hydrochloride), Eflornithine HCl 98+%. Offered by: Combi-blocks, Chemat Brand, TargetMol, GLPBio, Ambeed. Available pack sizes: 100mg, on request, 10mg, 50mg, 1g, 5g, 10g, 100 mg.
2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride (CAS 68278-23-9) is a chemical compound with the molecular formula C6H13ClF2N2O2 and a molecular weight of 218.63 g/mol. IUPAC name: 2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride. InChIKey: VKDGNNYJFSHYKD-UHFFFAOYSA-N.
| Molecular formula | C6H13ClF2N2O2 |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride |
| InChIKey | VKDGNNYJFSHYKD-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)F)(C(=O)O)N)CN.Cl |
Computed by PubChem (NCBI)