Products 69955-42-6
CAS 69955-42-6 appears in our catalog under these names: L-Eflornithine (monohydrochloride), 98.0%, L-Eflornithine (monohydrochloride), ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 10mM/1mL, 5 mg, 10mg.
(2S)-2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride (CAS 69955-42-6) is a chemical compound with the molecular formula C6H13ClF2N2O2 and a molecular weight of 218.63 g/mol. IUPAC name: (2S)-2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride. InChIKey: VKDGNNYJFSHYKD-FYZOBXCZSA-N.
| Molecular formula | C6H13ClF2N2O2 |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | (2S)-2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride |
| InChIKey | VKDGNNYJFSHYKD-FYZOBXCZSA-N |
| SMILES | C(C[C@@](C(F)F)(C(=O)O)N)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-Eflornithine (monohydrochloride), L-Eflornithine monohydrochloride, (2S)-2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride, (S)-2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride, L-EFLORNITHINE HYDROCHLORIDE, Eflornithine Hydrocloride, L-DFMO (monohydrochloride), VKDGNNYJFSHYKD-FYZOBXCZSA-N