Products 682804-10-0
CAS 682804-10-0 appears in our catalog under these names: 3-Amino-3-(2,4-dihydroxyphenyl)propanoic acid, 95%, 3–Amino–3–(2，4–dihydroxyphenyl)propanoic Acid, 3-Amino-3-(2，4-dihydroxyphenyl)propanoic Acid, >95%, >95%, 3-AMINO-3-(2,4-DIHYDROXYPHENYL)PROPANOIC ACID, >95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
3-amino-3-(2,4-dihydroxyphenyl)propanoic acid (CAS 682804-10-0) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 3-amino-3-(2,4-dihydroxyphenyl)propanoic acid. InChIKey: SLASMFLPYYVGRW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 3-amino-3-(2,4-dihydroxyphenyl)propanoic acid |
| InChIKey | SLASMFLPYYVGRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C(CC(=O)O)N |
Computed by PubChem (NCBI)