Products 68304-28-9

CAS 68304-28-9 is the registry number for Ethyl 6-cyclopropylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 6-cyclopropylpyridine-3-carboxylate (CAS 68304-28-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: ethyl 6-cyclopropylpyridine-3-carboxylate. InChIKey: UHWVGYRWRFFGQP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC nameethyl 6-cyclopropylpyridine-3-carboxylate
InChIKeyUHWVGYRWRFFGQP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(C=C1)C2CC2

Computed by PubChem (NCBI)