Products 68359-07-9
CAS 68359-07-9 appears in our catalog under these names: 5–Chloro–2–ethoxynicotinic acid, 5-Chloro-2-ethoxynicotinic acid 97%, 5-Chloro-2-ethoxy-3-pyridinecarboxylic acid, 97%, 97%, 5-Chloro-2-ethoxy-nicotinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-chloro-2-ethoxypyridine-3-carboxylic acid (CAS 68359-07-9) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-2-ethoxypyridine-3-carboxylic acid. InChIKey: DTIBPOFHVJBUSH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 5-chloro-2-ethoxypyridine-3-carboxylic acid |
| InChIKey | DTIBPOFHVJBUSH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)