Products 684223-68-5

CAS 684223-68-5 is the registry number for tert-Butyl 4-{imidazo[1,2-a]pyridin-6-yl}piperazine-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-imidazo[1,2-a]pyridin-6-ylpiperazine-1-carboxylate (CAS 684223-68-5) is a chemical compound with the molecular formula C16H22N4O2 and a molecular weight of 302.37 g/mol. IUPAC name: tert-butyl 4-imidazo[1,2-a]pyridin-6-ylpiperazine-1-carboxylate. InChIKey: SRIPNOBMGZDKKN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N4O2
Molecular weight302.37 g/mol
IUPAC nametert-butyl 4-imidazo[1,2-a]pyridin-6-ylpiperazine-1-carboxylate
InChIKeySRIPNOBMGZDKKN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=CN3C=CN=C3C=C2

Computed by PubChem (NCBI)