Products 848500-10-7

CAS 848500-10-7 is the registry number for tert-Butyl N-(1-(4-cyanopyridin-2-yl)piperidin-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(4-cyano-2-pyridinyl)piperidin-4-yl]carbamate (CAS 848500-10-7) is a chemical compound with the molecular formula C16H22N4O2 and a molecular weight of 302.37 g/mol. IUPAC name: tert-butyl N-[1-(4-cyano-2-pyridinyl)piperidin-4-yl]carbamate. InChIKey: QOCGFDAYKLIZKM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N4O2
Molecular weight302.37 g/mol
IUPAC nametert-butyl N-[1-(4-cyano-2-pyridinyl)piperidin-4-yl]carbamate
InChIKeyQOCGFDAYKLIZKM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCN(CC1)C2=NC=CC(=C2)C#N

Computed by PubChem (NCBI)