CAS 684270-46-0 appears in our catalog under these names: Fmoc-L-Dap(N3)-OH, 95%, Fmoc-L-azidoalanine, >95% (HPLC), Fmoc–β–azido–Ala–OH, Fmoc-L-Aza-OH (solv.), Fmoc-β-azidoalanine. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 50mg, 25g, 100g.
(2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 684270-46-0) is a chemical compound with the molecular formula C18H16N4O4 and a molecular weight of 352.3 g/mol. IUPAC name: (2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZITYCUDVCWLHPG-INIZCTEOSA-N.
| Molecular formula | C18H16N4O4 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | (2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZITYCUDVCWLHPG-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)