Products 880637-82-1

CAS 880637-82-1 is the registry number for N3-L-Dap(Fmoc)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.

Structural formula: {0} (CAS {1})

(2S)-2-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 880637-82-1) is a chemical compound with the molecular formula C18H16N4O4 and a molecular weight of 352.3 g/mol. IUPAC name: (2S)-2-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QJCYGENXFLOOKP-INIZCTEOSA-N.

Identity
Molecular formulaC18H16N4O4
Molecular weight352.3 g/mol
IUPAC name(2S)-2-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
InChIKeyQJCYGENXFLOOKP-INIZCTEOSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@@H](C(=O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)